C33H62O3Si2 — CID 132610122
(1E,2S,5S,10S,15R)-5,15-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6,6,10-tetramethyltricyclo[8.6.1.02,7]heptadec-1(16)-en-14-one (PubChem CID 132610122) has the molecular formula C33H62O3Si2 and a molecular weight of 563.03 g/mol. Its IUPAC name is (1E,2S,5S,10S,15R)-5,15-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6,6,10-tetramethyltricyclo[8.6.1.02,7]heptadec-1(16)-en-14-one.
| Compound Name | (1E,2S,5S,10S,15R)-5,15-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6,6,10-tetramethyltricyclo[8.6.1.02,7]heptadec-1(16)-en-14-one |
|---|---|
| PubChem CID | 132610122 |
| Molecular Formula | C33H62O3Si2 |
| Molecular Weight | 563.03 g/mol |
| Exact Mass | 562.42 |
| IUPAC Name | (1E,2S,5S,10S,15R)-5,15-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6,6,10-tetramethyltricyclo[8.6.1.02,7]heptadec-1(16)-en-14-one |
| SMILES | CC1(C)C2CC[C@]3(C)CCCC(=O)[C@H](O[Si](C)(C)C(C)(C)C)/C=C(\C3)[C@@]2(C)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H62O3Si2/c1-29(2,3)37(11,12)35-26-22-24-23-32(9,19-15-16-25(26)34)20-17-27-31(7,8)28(18-21-33(24,27)10)36-38(13,14)30(4,5)6/h22,26-28H,15-21,23H2,1-14H3/b24-22+/t26-,27?,28+,32+,33-/m1/s1 |
| InChIKey | VNAIIIOQMBDMDJ-GQLCMYAJSA-N |
| XLogP | 10.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.03 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|