C27H29FN2O2 — CID 132610904
N-ethyl-2-[(4-fluorophenyl)methyl-[2-(4-methylphenyl)acetyl]amino]-3-phenylpropanamide (PubChem CID 132610904) has the molecular formula C27H29FN2O2 and a molecular weight of 432.54 g/mol. Its IUPAC name is N-ethyl-2-[(4-fluorophenyl)methyl-[2-(4-methylphenyl)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-ethyl-2-[(4-fluorophenyl)methyl-[2-(4-methylphenyl)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 132610904 |
| Molecular Formula | C27H29FN2O2 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-ethyl-2-[(4-fluorophenyl)methyl-[2-(4-methylphenyl)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCNC(=O)C(Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C27H29FN2O2/c1-3-29-27(32)25(17-21-7-5-4-6-8-21)30(19-23-13-15-24(28)16-14-23)26(31)18-22-11-9-20(2)10-12-22/h4-16,25H,3,17-19H2,1-2H3,(H,29,32) |
| InChIKey | MDHHFFWDCUSYAF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |