C21H15N3O2S2 — CID 1326118
(E)-3-(furan-2-yl)-N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]prop-2-enamide (PubChem CID 1326118) has the molecular formula C21H15N3O2S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 1326118 |
| Molecular Formula | C21H15N3O2S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NC(=S)Nc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C21H15N3O2S2/c25-19(10-9-17-6-3-11-26-17)23-20(27)24-21-22-18(13-28-21)16-8-7-14-4-1-2-5-15(14)12-16/h1-13H,(H2,22,23,24,25,27)/b10-9+ |
| InChIKey | OUPFBMURMOHKSS-MDZDMXLPSA-N |
| XLogP | 5.08 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|