C24H29ClN2O4 — CID 132612233
2-[[2-(2-chlorophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclopentylpropanamide (PubChem CID 132612233) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclopentylpropanamide.
| Compound Name | 2-[[2-(2-chlorophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 132612233 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[[2-(2-chlorophenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclopentylpropanamide |
| SMILES | COc1cccc(CN(C(=O)COc2ccccc2Cl)C(C)C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C24H29ClN2O4/c1-17(24(29)26-19-9-3-4-10-19)27(15-18-8-7-11-20(14-18)30-2)23(28)16-31-22-13-6-5-12-21(22)25/h5-8,11-14,17,19H,3-4,9-10,15-16H2,1-2H3,(H,26,29) |
| InChIKey | GUFLQQYPIOTYHB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |