About 2-oxodecyl acetate
2-oxodecyl acetate (PubChem CID 13261337) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 2-oxodecyl acetate.
Molecular Properties
| Compound Name | 2-oxodecyl acetate |
| PubChem CID | 13261337 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 2-oxodecyl acetate |
| SMILES | CCCCCCCCC(=O)COC(C)=O |
| InChI | InChI=1S/C12H22O3/c1-3-4-5-6-7-8-9-12(14)10-15-11(2)13/h3-10H2,1-2H3 |
| InChIKey | GWNBOOXEQUCIAQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-oxodecyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxodecyl acetate?
The IUPAC name of 2-oxodecyl acetate (CID 13261337) is 2-oxodecyl acetate.
What is the SMILES notation for 2-oxodecyl acetate?
The canonical SMILES for 2-oxodecyl acetate is CCCCCCCCC(=O)COC(C)=O.
What is the InChIKey of 2-oxodecyl acetate?
The InChIKey is GWNBOOXEQUCIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-3-4-5-6-7-8-9-12(14)10-15-11(2)13/h3-10H2,1-2H3.
What are the key properties of 2-oxodecyl acetate?
2-oxodecyl acetate has a molecular weight of 214.30 g/mol, XLogP of 2.87, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxodecyl acetate is sourced from PubChem (CID 13261337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).