About ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate
ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 13261363) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| PubChem CID | 13261363 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCCCC1CC(C(=O)OCC)=NN1c1ccccc1 |
| InChI | InChI=1S/C16H22N2O2/c1-3-5-9-14-12-15(16(19)20-4-2)17-18(14)13-10-7-6-8-11-13/h6-8,10-11,14H,3-5,9,12H2,1-2H3 |
| InChIKey | SOQMOHJXRYHFCI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
The IUPAC name of ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate (CID 13261363) is ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
What is the SMILES notation for ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
The canonical SMILES for ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate is CCCCC1CC(C(=O)OCC)=NN1c1ccccc1.
What is the InChIKey of ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
The InChIKey is SOQMOHJXRYHFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-3-5-9-14-12-15(16(19)20-4-2)17-18(14)13-10-7-6-8-11-13/h6-8,10-11,14H,3-5,9,12H2,1-2H3.
What are the key properties of ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate has a molecular weight of 274.36 g/mol, XLogP of 3.37, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate is sourced from PubChem (CID 13261363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).