C16H18N2O6 — CID 13261367
5-O-ethyl 3-O,4-O-dimethyl (3R,4S)-2-phenyl-3,4-dihydropyrazole-3,4,5-tricarboxylate (PubChem CID 13261367) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is 5-O-ethyl 3-O,4-O-dimethyl (3R,4S)-2-phenyl-3,4-dihydropyrazole-3,4,5-tricarboxylate.
| Compound Name | 5-O-ethyl 3-O,4-O-dimethyl (3R,4S)-2-phenyl-3,4-dihydropyrazole-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 13261367 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 5-O-ethyl 3-O,4-O-dimethyl (3R,4S)-2-phenyl-3,4-dihydropyrazole-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)[C@@H](C(=O)OC)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C16H18N2O6/c1-4-24-15(20)12-11(14(19)22-2)13(16(21)23-3)18(17-12)10-8-6-5-7-9-10/h5-9,11,13H,4H2,1-3H3/t11-,13-/m1/s1 |
| InChIKey | GNLPMWGFSXMCLK-DGCLKSJQSA-N |
| XLogP | 0.76 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|