C28H32N2O2S — CID 132614137
2-[benzyl-[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-N-ethyl-3-phenylpropanamide (PubChem CID 132614137) has the molecular formula C28H32N2O2S and a molecular weight of 460.64 g/mol. Its IUPAC name is 2-[benzyl-[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-N-ethyl-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-N-ethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132614137 |
| Molecular Formula | C28H32N2O2S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 2-[benzyl-[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-N-ethyl-3-phenylpropanamide |
| SMILES | CCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CSCc1ccccc1C |
| InChI | InChI=1S/C28H32N2O2S/c1-3-29-28(32)26(18-23-13-6-4-7-14-23)30(19-24-15-8-5-9-16-24)27(31)21-33-20-25-17-11-10-12-22(25)2/h4-17,26H,3,18-21H2,1-2H3,(H,29,32) |
| InChIKey | POUTXRLGRMMWLJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |