C23H29BrN2O3 — CID 132614233
2-[(4-bromophenyl)methyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-methylpropanamide (PubChem CID 132614233) has the molecular formula C23H29BrN2O3 and a molecular weight of 461.40 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-methylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 132614233 |
| Molecular Formula | C23H29BrN2O3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C23H29BrN2O3/c1-16(22(28)25-5)26(14-17-10-12-18(24)13-11-17)21(27)15-29-20-9-7-6-8-19(20)23(2,3)4/h6-13,16H,14-15H2,1-5H3,(H,25,28) |
| InChIKey | LWHIZCQEZPSFFB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |