C24H25ClN2O5S — CID 132617871
4-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 132617871) has the molecular formula C24H25ClN2O5S and a molecular weight of 488.99 g/mol. Its IUPAC name is 4-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 132617871 |
| Molecular Formula | C24H25ClN2O5S |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 4-chloro-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(C(C)NC(=O)c2ccc(Cl)c(S(=O)(=O)Nc3ccc(C)cc3)c2)cc1OC |
| InChI | InChI=1S/C24H25ClN2O5S/c1-15-5-9-19(10-6-15)27-33(29,30)23-14-18(7-11-20(23)25)24(28)26-16(2)17-8-12-21(31-3)22(13-17)32-4/h5-14,16,27H,1-4H3,(H,26,28) |
| InChIKey | SLPSGCMBGMCVGC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |