C26H33BrN2O3 — CID 132619549
2-[[2-(4-bromophenoxy)acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 132619549) has the molecular formula C26H33BrN2O3 and a molecular weight of 501.47 g/mol. Its IUPAC name is 2-[[2-(4-bromophenoxy)acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[[2-(4-bromophenoxy)acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132619549 |
| Molecular Formula | C26H33BrN2O3 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 2-[[2-(4-bromophenoxy)acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccccc1C)C(=O)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H33BrN2O3/c1-3-24(26(31)28-22-11-5-4-6-12-22)29(17-20-10-8-7-9-19(20)2)25(30)18-32-23-15-13-21(27)14-16-23/h7-10,13-16,22,24H,3-6,11-12,17-18H2,1-2H3,(H,28,31) |
| InChIKey | ZAARUBMUWADKKN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |