C25H31BrN2O2S — CID 132619785
2-[benzyl-[2-[(4-bromophenyl)methylsulfanyl]acetyl]amino]-N-cyclohexylpropanamide (PubChem CID 132619785) has the molecular formula C25H31BrN2O2S and a molecular weight of 503.51 g/mol. Its IUPAC name is 2-[benzyl-[2-[(4-bromophenyl)methylsulfanyl]acetyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 2-[benzyl-[2-[(4-bromophenyl)methylsulfanyl]acetyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 132619785 |
| Molecular Formula | C25H31BrN2O2S |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 2-[benzyl-[2-[(4-bromophenyl)methylsulfanyl]acetyl]amino]-N-cyclohexylpropanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CSCc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H31BrN2O2S/c1-19(25(30)27-23-10-6-3-7-11-23)28(16-20-8-4-2-5-9-20)24(29)18-31-17-21-12-14-22(26)15-13-21/h2,4-5,8-9,12-15,19,23H,3,6-7,10-11,16-18H2,1H3,(H,27,30) |
| InChIKey | MKBCPEQICXMQHI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |