C26H26BrClN2O2 — CID 132621239
2-[(4-bromophenyl)methyl-[2-(3-chlorophenyl)acetyl]amino]-N-ethyl-3-phenylpropanamide (PubChem CID 132621239) has the molecular formula C26H26BrClN2O2 and a molecular weight of 513.86 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(3-chlorophenyl)acetyl]amino]-N-ethyl-3-phenylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(3-chlorophenyl)acetyl]amino]-N-ethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132621239 |
| Molecular Formula | C26H26BrClN2O2 |
| Molecular Weight | 513.86 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(3-chlorophenyl)acetyl]amino]-N-ethyl-3-phenylpropanamide |
| SMILES | CCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H26BrClN2O2/c1-2-29-26(32)24(16-19-7-4-3-5-8-19)30(18-20-11-13-22(27)14-12-20)25(31)17-21-9-6-10-23(28)15-21/h3-15,24H,2,16-18H2,1H3,(H,29,32) |
| InChIKey | JHZJEUYMKOIECQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.86 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |