About 5-butoxy-1-methoxyhexane
5-butoxy-1-methoxyhexane (PubChem CID 13262441) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is 5-butoxy-1-methoxyhexane.
Molecular Properties
| Compound Name | 5-butoxy-1-methoxyhexane |
| PubChem CID | 13262441 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 5-butoxy-1-methoxyhexane |
| SMILES | CCCCOC(C)CCCCOC |
| InChI | InChI=1S/C11H24O2/c1-4-5-10-13-11(2)8-6-7-9-12-3/h11H,4-10H2,1-3H3 |
| InChIKey | IVRIVRLBLHSFPF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-1-methoxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-1-methoxyhexane?
The IUPAC name of 5-butoxy-1-methoxyhexane (CID 13262441) is 5-butoxy-1-methoxyhexane.
What is the SMILES notation for 5-butoxy-1-methoxyhexane?
The canonical SMILES for 5-butoxy-1-methoxyhexane is CCCCOC(C)CCCCOC.
What is the InChIKey of 5-butoxy-1-methoxyhexane?
The InChIKey is IVRIVRLBLHSFPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2/c1-4-5-10-13-11(2)8-6-7-9-12-3/h11H,4-10H2,1-3H3.
What are the key properties of 5-butoxy-1-methoxyhexane?
5-butoxy-1-methoxyhexane has a molecular weight of 188.31 g/mol, XLogP of 3.01, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-1-methoxyhexane is sourced from PubChem (CID 13262441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).