C10H21ClN2O4S — CID 13262642
[(Z)-3-(dimethylamino)-2-propylsulfanylprop-2-enylidene]-dimethylazanium perchlorate (PubChem CID 13262642) has the molecular formula C10H21ClN2O4S and a molecular weight of 300.81 g/mol. Its IUPAC name is [(Z)-3-(dimethylamino)-2-propylsulfanylprop-2-enylidene]-dimethylazanium perchlorate.
| Compound Name | [(Z)-3-(dimethylamino)-2-propylsulfanylprop-2-enylidene]-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 13262642 |
| Molecular Formula | C10H21ClN2O4S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | [(Z)-3-(dimethylamino)-2-propylsulfanylprop-2-enylidene]-dimethylazanium perchlorate |
| SMILES | CCCS/C(C=[N+](C)C)=C\N(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C10H21N2S.ClHO4/c1-6-7-13-10(8-11(2)3)9-12(4)5;2-1(3,4)5/h8-9H,6-7H2,1-5H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | BNCFIDYDFMHNIC-UHFFFAOYSA-M |
| XLogP | -2.88 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|