C9H8F13NO — CID 13262943
2-[difluoro(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)methyl]-2,3,3,3-tetrafluoro-N,N-dimethylpropan-1-amine (PubChem CID 13262943) has the molecular formula C9H8F13NO and a molecular weight of 393.14 g/mol. Its IUPAC name is 2-[difluoro(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)methyl]-2,3,3,3-tetrafluoro-N,N-dimethylpropan-1-amine.
| Compound Name | 2-[difluoro(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)methyl]-2,3,3,3-tetrafluoro-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 13262943 |
| Molecular Formula | C9H8F13NO |
| Molecular Weight | 393.14 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-[difluoro(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)methyl]-2,3,3,3-tetrafluoro-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC(F)(C(F)(F)F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F13NO/c1-23(2)3-4(10,6(12,13)14)9(21,22)24-5(11,7(15,16)17)8(18,19)20/h3H2,1-2H3 |
| InChIKey | GCZHXUAGLQIGRH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |