About ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate
ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate (PubChem CID 13262953) has the molecular formula C6H6F4O2
and a molecular weight of 186.10 g/mol. Its IUPAC name is ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate |
| PubChem CID | 13262953 |
| Molecular Formula | C6H6F4O2 |
| Molecular Weight | 186.10 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate |
| SMILES | CCOC(=O)/C(F)=C/C(F)(F)F |
| InChI | InChI=1S/C6H6F4O2/c1-2-12-5(11)4(7)3-6(8,9)10/h3H,2H2,1H3/b4-3- |
| InChIKey | WJDYFJGXRPFBEH-ARJAWSKDSA-N |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.10 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate?
The IUPAC name of ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate (CID 13262953) is ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate.
What is the SMILES notation for ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate?
The canonical SMILES for ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate is CCOC(=O)/C(F)=C/C(F)(F)F.
What is the InChIKey of ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate?
The InChIKey is WJDYFJGXRPFBEH-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H6F4O2/c1-2-12-5(11)4(7)3-6(8,9)10/h3H,2H2,1H3/b4-3-.
What are the key properties of ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate?
ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate has a molecular weight of 186.10 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-2,4,4,4-tetrafluorobut-2-enoate is sourced from PubChem (CID 13262953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).