About 2-hexylsulfanylacetic acid
2-hexylsulfanylacetic acid (PubChem CID 13263041) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is 2-hexylsulfanylacetic acid.
Molecular Properties
| Compound Name | 2-hexylsulfanylacetic acid |
| PubChem CID | 13263041 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-hexylsulfanylacetic acid |
| SMILES | CCCCCCSCC(=O)O |
| InChI | InChI=1S/C8H16O2S/c1-2-3-4-5-6-11-7-8(9)10/h2-7H2,1H3,(H,9,10) |
| InChIKey | GTZOWLKALUSVJL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylsulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylsulfanylacetic acid?
The IUPAC name of 2-hexylsulfanylacetic acid (CID 13263041) is 2-hexylsulfanylacetic acid.
What is the SMILES notation for 2-hexylsulfanylacetic acid?
The canonical SMILES for 2-hexylsulfanylacetic acid is CCCCCCSCC(=O)O.
What is the InChIKey of 2-hexylsulfanylacetic acid?
The InChIKey is GTZOWLKALUSVJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S/c1-2-3-4-5-6-11-7-8(9)10/h2-7H2,1H3,(H,9,10).
What are the key properties of 2-hexylsulfanylacetic acid?
2-hexylsulfanylacetic acid has a molecular weight of 176.28 g/mol, XLogP of 2.38, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylsulfanylacetic acid is sourced from PubChem (CID 13263041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).