C32H38N4O7S — CID 132639622
2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 132639622) has the molecular formula C32H38N4O7S and a molecular weight of 622.74 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132639622 |
| Molecular Formula | C32H38N4O7S |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1cccc(OC)c1)C(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H38N4O7S/c1-3-30(32(38)33-25-12-6-4-7-13-25)34(22-24-11-10-14-28(21-24)43-2)31(37)23-35(26-17-19-27(20-18-26)36(39)40)44(41,42)29-15-8-5-9-16-29/h5,8-11,14-21,25,30H,3-4,6-7,12-13,22-23H2,1-2H3,(H,33,38) |
| InChIKey | BHVIHXCMUNACHX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|