About methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate
methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate (PubChem CID 13264538) has the molecular formula C13H21NO4
and a molecular weight of 255.31 g/mol. Its IUPAC name is methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate.
Molecular Properties
| Compound Name | methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate |
| PubChem CID | 13264538 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate |
| SMILES | C=C=CC(CCC(=O)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO4/c1-6-7-10(8-9-11(15)17-5)14-12(16)18-13(2,3)4/h7,10H,1,8-9H2,2-5H3,(H,14,16) |
| InChIKey | PADVEDDXSKZFRP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate?
The IUPAC name of methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate (CID 13264538) is methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate.
What is the SMILES notation for methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate?
The canonical SMILES for methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate is C=C=CC(CCC(=O)OC)NC(=O)OC(C)(C)C.
What is the InChIKey of methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate?
The InChIKey is PADVEDDXSKZFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO4/c1-6-7-10(8-9-11(15)17-5)14-12(16)18-13(2,3)4/h7,10H,1,8-9H2,2-5H3,(H,14,16).
What are the key properties of methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate?
methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate has a molecular weight of 255.31 g/mol, XLogP of 2.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-5,6-dienoate is sourced from PubChem (CID 13264538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).