C33H34IN3O4S — CID 132646864
2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-ethyl-3-phenylpropanamide (PubChem CID 132646864) has the molecular formula C33H34IN3O4S and a molecular weight of 695.62 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-ethyl-3-phenylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-ethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132646864 |
| Molecular Formula | C33H34IN3O4S |
| Molecular Weight | 695.62 g/mol |
| Exact Mass | 695.13 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-methylphenyl)methyl]amino]-N-ethyl-3-phenylpropanamide |
| SMILES | CCNC(=O)C(Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H34IN3O4S/c1-3-35-33(39)31(22-26-12-6-4-7-13-26)36(23-27-14-10-11-25(2)21-27)32(38)24-37(29-19-17-28(34)18-20-29)42(40,41)30-15-8-5-9-16-30/h4-21,31H,3,22-24H2,1-2H3,(H,35,39) |
| InChIKey | DLXIYLLIUWDIFJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|