C3H7N5O3 — CID 132647845
aminoazanium;4,6-dioxo-1H-1,3,5-triazin-2-olate (PubChem CID 132647845) has the molecular formula C3H7N5O3 and a molecular weight of 161.12 g/mol. Its IUPAC name is aminoazanium;4,6-dioxo-1H-1,3,5-triazin-2-olate.
| Compound Name | aminoazanium;4,6-dioxo-1H-1,3,5-triazin-2-olate |
|---|---|
| PubChem CID | 132647845 |
| Molecular Formula | C3H7N5O3 |
| Molecular Weight | 161.12 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | aminoazanium;4,6-dioxo-1H-1,3,5-triazin-2-olate |
| SMILES | N[NH3+].O=c1nc([O-])[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C3H3N3O3.H4N2/c7-1-4-2(8)6-3(9)5-1;1-2/h(H3,4,5,6,7,8,9);1-2H2 |
| InChIKey | REWJAYUHYGWDJT-UHFFFAOYSA-N |
| XLogP | -4.37 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.12 |
| LogP ≤ 5 | -4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|