About undecane-3,6-dione
undecane-3,6-dione (PubChem CID 13264813) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is undecane-3,6-dione.
Molecular Properties
| Compound Name | undecane-3,6-dione |
| PubChem CID | 13264813 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | undecane-3,6-dione |
| SMILES | CCCCCC(=O)CCC(=O)CC |
| InChI | InChI=1S/C11H20O2/c1-3-5-6-7-11(13)9-8-10(12)4-2/h3-9H2,1-2H3 |
| InChIKey | KWHQQLQVDJMZTG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecane-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecane-3,6-dione?
The IUPAC name of undecane-3,6-dione (CID 13264813) is undecane-3,6-dione.
What is the SMILES notation for undecane-3,6-dione?
The canonical SMILES for undecane-3,6-dione is CCCCCC(=O)CCC(=O)CC.
What is the InChIKey of undecane-3,6-dione?
The InChIKey is KWHQQLQVDJMZTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-3-5-6-7-11(13)9-8-10(12)4-2/h3-9H2,1-2H3.
What are the key properties of undecane-3,6-dione?
undecane-3,6-dione has a molecular weight of 184.28 g/mol, XLogP of 2.90, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for undecane-3,6-dione is sourced from PubChem (CID 13264813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).