C15H22N2OSi — CID 132648547
(1R,3S,3aS,6aS)-3a,6a-dimethyl-3-trimethylsilyloxy-2,4-dihydro-1H-pentalene-1,3-dicarbonitrile (PubChem CID 132648547) has the molecular formula C15H22N2OSi and a molecular weight of 274.44 g/mol. Its IUPAC name is (1R,3S,3aS,6aS)-3a,6a-dimethyl-3-trimethylsilyloxy-2,4-dihydro-1H-pentalene-1,3-dicarbonitrile.
| Compound Name | (1R,3S,3aS,6aS)-3a,6a-dimethyl-3-trimethylsilyloxy-2,4-dihydro-1H-pentalene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 132648547 |
| Molecular Formula | C15H22N2OSi |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (1R,3S,3aS,6aS)-3a,6a-dimethyl-3-trimethylsilyloxy-2,4-dihydro-1H-pentalene-1,3-dicarbonitrile |
| SMILES | C[C@]12CC=C[C@@]1(C)[C@H](C#N)C[C@]2(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C15H22N2OSi/c1-13-7-6-8-14(13,2)15(11-17,9-12(13)10-16)18-19(3,4)5/h6-7,12H,8-9H2,1-5H3/t12-,13-,14-,15+/m0/s1 |
| InChIKey | ZUPWBPAJSDRCLZ-ZQDZILKHSA-N |
| XLogP | 3.62 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|