C20H21NO2 — CID 132650331
N-[1-(3,4-dimethylphenyl)propyl]-1-benzofuran-2-carboxamide (PubChem CID 132650331) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)propyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)propyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 132650331 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)propyl]-1-benzofuran-2-carboxamide |
| SMILES | CCC(NC(=O)c1cc2ccccc2o1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H21NO2/c1-4-17(15-10-9-13(2)14(3)11-15)21-20(22)19-12-16-7-5-6-8-18(16)23-19/h5-12,17H,4H2,1-3H3,(H,21,22) |
| InChIKey | DMXISWCUUKAIMA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |