C21H27NO — CID 132650390
N-[1-(2,4-dimethylphenyl)propyl]-3-(4-methylphenyl)propanamide (PubChem CID 132650390) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)propyl]-3-(4-methylphenyl)propanamide.
| Compound Name | N-[1-(2,4-dimethylphenyl)propyl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 132650390 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)propyl]-3-(4-methylphenyl)propanamide |
| SMILES | CCC(NC(=O)CCc1ccc(C)cc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C21H27NO/c1-5-20(19-12-8-16(3)14-17(19)4)22-21(23)13-11-18-9-6-15(2)7-10-18/h6-10,12,14,20H,5,11,13H2,1-4H3,(H,22,23) |
| InChIKey | XWTAGGODLAYAIM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |