C15H20Cl2N2O2 — CID 132651489
2-[(2,6-dichlorophenyl)methyl-propanoylamino]-N-methylbutanamide (PubChem CID 132651489) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl-propanoylamino]-N-methylbutanamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl-propanoylamino]-N-methylbutanamide |
|---|---|
| PubChem CID | 132651489 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl-propanoylamino]-N-methylbutanamide |
| SMILES | CCC(=O)N(Cc1c(Cl)cccc1Cl)C(CC)C(=O)NC |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-4-13(15(21)18-3)19(14(20)5-2)9-10-11(16)7-6-8-12(10)17/h6-8,13H,4-5,9H2,1-3H3,(H,18,21) |
| InChIKey | ZSYFGFMUXAXOIB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |