C20H23FN2O2 — CID 132652351
2-[[2-(2-fluorophenyl)acetyl]-[(2-methylphenyl)methyl]amino]-N-methylpropanamide (PubChem CID 132652351) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 2-[[2-(2-fluorophenyl)acetyl]-[(2-methylphenyl)methyl]amino]-N-methylpropanamide.
| Compound Name | 2-[[2-(2-fluorophenyl)acetyl]-[(2-methylphenyl)methyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 132652351 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[[2-(2-fluorophenyl)acetyl]-[(2-methylphenyl)methyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)N(Cc1ccccc1C)C(=O)Cc1ccccc1F |
| InChI | InChI=1S/C20H23FN2O2/c1-14-8-4-5-10-17(14)13-23(15(2)20(25)22-3)19(24)12-16-9-6-7-11-18(16)21/h4-11,15H,12-13H2,1-3H3,(H,22,25) |
| InChIKey | LVXVGUVOTSLAKB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |