C16H22Cl2N2O2 — CID 132652594
2-[(2,4-dichlorophenyl)methyl-propanoylamino]-N-propan-2-ylpropanamide (PubChem CID 132652594) has the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.27 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl-propanoylamino]-N-propan-2-ylpropanamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl-propanoylamino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 132652594 |
| Molecular Formula | C16H22Cl2N2O2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl-propanoylamino]-N-propan-2-ylpropanamide |
| SMILES | CCC(=O)N(Cc1ccc(Cl)cc1Cl)C(C)C(=O)NC(C)C |
| InChI | InChI=1S/C16H22Cl2N2O2/c1-5-15(21)20(11(4)16(22)19-10(2)3)9-12-6-7-13(17)8-14(12)18/h6-8,10-11H,5,9H2,1-4H3,(H,19,22) |
| InChIKey | UBLVOLNIKOKLDI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |