About 4-(methoxymethyl)-2,6-dimethylaniline
4-(methoxymethyl)-2,6-dimethylaniline (PubChem CID 13265329) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-(methoxymethyl)-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-(methoxymethyl)-2,6-dimethylaniline |
| PubChem CID | 13265329 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-(methoxymethyl)-2,6-dimethylaniline |
| SMILES | COCc1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/C10H15NO/c1-7-4-9(6-12-3)5-8(2)10(7)11/h4-5H,6,11H2,1-3H3 |
| InChIKey | YCJZLKNEQICBTO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(methoxymethyl)-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)-2,6-dimethylaniline?
The IUPAC name of 4-(methoxymethyl)-2,6-dimethylaniline (CID 13265329) is 4-(methoxymethyl)-2,6-dimethylaniline.
What is the SMILES notation for 4-(methoxymethyl)-2,6-dimethylaniline?
The canonical SMILES for 4-(methoxymethyl)-2,6-dimethylaniline is COCc1cc(C)c(N)c(C)c1.
What is the InChIKey of 4-(methoxymethyl)-2,6-dimethylaniline?
The InChIKey is YCJZLKNEQICBTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-7-4-9(6-12-3)5-8(2)10(7)11/h4-5H,6,11H2,1-3H3.
What are the key properties of 4-(methoxymethyl)-2,6-dimethylaniline?
4-(methoxymethyl)-2,6-dimethylaniline has a molecular weight of 165.24 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)-2,6-dimethylaniline is sourced from PubChem (CID 13265329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).