C21H25NO4 — CID 132653574
(E)-N-[1-(3,4-dimethoxyphenyl)propyl]-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 132653574) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (E)-N-[1-(3,4-dimethoxyphenyl)propyl]-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-(3,4-dimethoxyphenyl)propyl]-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 132653574 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (E)-N-[1-(3,4-dimethoxyphenyl)propyl]-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | CCC(NC(=O)/C=C/c1ccccc1OC)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H25NO4/c1-5-17(16-10-12-19(25-3)20(14-16)26-4)22-21(23)13-11-15-8-6-7-9-18(15)24-2/h6-14,17H,5H2,1-4H3,(H,22,23)/b13-11+ |
| InChIKey | UMWSVNGYWSSCHV-ACCUITESSA-N |
| XLogP | 3.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|