About 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide
2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide (PubChem CID 132654863) has the molecular formula C23H30N2O2
and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide.
Molecular Properties
| Compound Name | 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide |
| PubChem CID | 132654863 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide |
| SMILES | Cc1ccc(C)c(CC(=O)N(Cc2ccccc2)C(C)C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-16(2)24-23(27)19(5)25(15-20-9-7-6-8-10-20)22(26)14-21-13-17(3)11-12-18(21)4/h6-13,16,19H,14-15H2,1-5H3,(H,24,27) |
| InChIKey | CWXJIOIKUBCCHB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide?
The IUPAC name of 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide (CID 132654863) is 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide.
What is the SMILES notation for 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide?
The canonical SMILES for 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide is Cc1ccc(C)c(CC(=O)N(Cc2ccccc2)C(C)C(=O)NC(C)C)c1.
What is the InChIKey of 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide?
The InChIKey is CWXJIOIKUBCCHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O2/c1-16(2)24-23(27)19(5)25(15-20-9-7-6-8-10-20)22(26)14-21-13-17(3)11-12-18(21)4/h6-13,16,19H,14-15H2,1-5H3,(H,24,27).
What are the key properties of 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide?
2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide has a molecular weight of 366.51 g/mol, XLogP of 3.79, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide is sourced from PubChem (CID 132654863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).