C23H30N2O2 — CID 132654863
2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide (PubChem CID 132654863) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 132654863 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-[benzyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-propan-2-ylpropanamide |
| SMILES | Cc1ccc(C)c(CC(=O)N(Cc2ccccc2)C(C)C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-16(2)24-23(27)19(5)25(15-20-9-7-6-8-10-20)22(26)14-21-13-17(3)11-12-18(21)4/h6-13,16,19H,14-15H2,1-5H3,(H,24,27) |
| InChIKey | CWXJIOIKUBCCHB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |