C10H12Cl2O — CID 13265531
4-(dichloromethyl)-2,4,6-trimethylcyclohexa-2,5-dien-1-one (PubChem CID 13265531) has the molecular formula C10H12Cl2O and a molecular weight of 219.11 g/mol. Its IUPAC name is 4-(dichloromethyl)-2,4,6-trimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-(dichloromethyl)-2,4,6-trimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 13265531 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 4-(dichloromethyl)-2,4,6-trimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(C)(C(Cl)Cl)C=C(C)C1=O |
| InChI | InChI=1S/C10H12Cl2O/c1-6-4-10(3,9(11)12)5-7(2)8(6)13/h4-5,9H,1-3H3 |
| InChIKey | SROIDXDTTVPRNA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|