C18H19BrFNO2 — CID 132656992
N-(4-bromo-2-fluorophenyl)-2-(3,5-dimethylphenoxy)butanamide (PubChem CID 132656992) has the molecular formula C18H19BrFNO2 and a molecular weight of 380.26 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-(3,5-dimethylphenoxy)butanamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-(3,5-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 132656992 |
| Molecular Formula | C18H19BrFNO2 |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-(3,5-dimethylphenoxy)butanamide |
| SMILES | CCC(Oc1cc(C)cc(C)c1)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C18H19BrFNO2/c1-4-17(23-14-8-11(2)7-12(3)9-14)18(22)21-16-6-5-13(19)10-15(16)20/h5-10,17H,4H2,1-3H3,(H,21,22) |
| InChIKey | LAMJPDSVSWMVSA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |