About 6-methylidenecyclohexa-2,4-dien-1-one
6-methylidenecyclohexa-2,4-dien-1-one (PubChem CID 13265823) has the molecular formula C7H6O
and a molecular weight of 106.12 g/mol. Its IUPAC name is 6-methylidenecyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-methylidenecyclohexa-2,4-dien-1-one |
| PubChem CID | 13265823 |
| Molecular Formula | C7H6O |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.04 |
| IUPAC Name | 6-methylidenecyclohexa-2,4-dien-1-one |
| SMILES | C=C1C=CC=CC1=O |
| InChI | InChI=1S/C7H6O/c1-6-4-2-3-5-7(6)8/h2-5H,1H2 |
| InChIKey | NSDWWGAIPUNJAX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methylidenecyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidenecyclohexa-2,4-dien-1-one?
The IUPAC name of 6-methylidenecyclohexa-2,4-dien-1-one (CID 13265823) is 6-methylidenecyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-methylidenecyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-methylidenecyclohexa-2,4-dien-1-one is C=C1C=CC=CC1=O.
What is the InChIKey of 6-methylidenecyclohexa-2,4-dien-1-one?
The InChIKey is NSDWWGAIPUNJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O/c1-6-4-2-3-5-7(6)8/h2-5H,1H2.
What are the key properties of 6-methylidenecyclohexa-2,4-dien-1-one?
6-methylidenecyclohexa-2,4-dien-1-one has a molecular weight of 106.12 g/mol, XLogP of 1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidenecyclohexa-2,4-dien-1-one is sourced from PubChem (CID 13265823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).