C25H27NO3 — CID 132659061
2-(3,5-dimethylphenoxy)-N-(4-phenylmethoxyphenyl)butanamide (PubChem CID 132659061) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-(4-phenylmethoxyphenyl)butanamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-(4-phenylmethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 132659061 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-(4-phenylmethoxyphenyl)butanamide |
| SMILES | CCC(Oc1cc(C)cc(C)c1)C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO3/c1-4-24(29-23-15-18(2)14-19(3)16-23)25(27)26-21-10-12-22(13-11-21)28-17-20-8-6-5-7-9-20/h5-16,24H,4,17H2,1-3H3,(H,26,27) |
| InChIKey | LNSDBTXUESLSPC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |