C20H22Cl2N2O2 — CID 132659751
2-[benzyl-[2-(2,4-dichlorophenyl)acetyl]amino]-N-ethylpropanamide (PubChem CID 132659751) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is 2-[benzyl-[2-(2,4-dichlorophenyl)acetyl]amino]-N-ethylpropanamide.
| Compound Name | 2-[benzyl-[2-(2,4-dichlorophenyl)acetyl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 132659751 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[benzyl-[2-(2,4-dichlorophenyl)acetyl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(Cc1ccccc1)C(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-3-23-20(26)14(2)24(13-15-7-5-4-6-8-15)19(25)11-16-9-10-17(21)12-18(16)22/h4-10,12,14H,3,11,13H2,1-2H3,(H,23,26) |
| InChIKey | GFOKZKVOVGIJLE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |