C19H29ClN2O3S — CID 132661488
2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-cyclooctylpropanamide (PubChem CID 132661488) has the molecular formula C19H29ClN2O3S and a molecular weight of 400.97 g/mol. Its IUPAC name is 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-cyclooctylpropanamide.
| Compound Name | 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-cyclooctylpropanamide |
|---|---|
| PubChem CID | 132661488 |
| Molecular Formula | C19H29ClN2O3S |
| Molecular Weight | 400.97 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-cyclooctylpropanamide |
| SMILES | Cc1ccc(N(C(C)C(=O)NC2CCCCCCC2)S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C19H29ClN2O3S/c1-14-11-12-17(13-18(14)20)22(26(3,24)25)15(2)19(23)21-16-9-7-5-4-6-8-10-16/h11-13,15-16H,4-10H2,1-3H3,(H,21,23) |
| InChIKey | STVDPRXLVWNTLP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.97 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |