C21H24Cl2N2O2 — CID 132663006
2-[(3,4-dichlorophenyl)methyl-(3-phenylpropanoyl)amino]-N-methylbutanamide (PubChem CID 132663006) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl-(3-phenylpropanoyl)amino]-N-methylbutanamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl-(3-phenylpropanoyl)amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 132663006 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl-(3-phenylpropanoyl)amino]-N-methylbutanamide |
| SMILES | CCC(C(=O)NC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-3-19(21(27)24-2)25(14-16-9-11-17(22)18(23)13-16)20(26)12-10-15-7-5-4-6-8-15/h4-9,11,13,19H,3,10,12,14H2,1-2H3,(H,24,27) |
| InChIKey | CMJXKOVWXHXXTQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |