C19H20F2N2O4S — CID 132663564
2-(3,4-difluoro-N-methylsulfonylanilino)-N-(4-prop-2-enoxyphenyl)propanamide (PubChem CID 132663564) has the molecular formula C19H20F2N2O4S and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-(3,4-difluoro-N-methylsulfonylanilino)-N-(4-prop-2-enoxyphenyl)propanamide.
| Compound Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-(4-prop-2-enoxyphenyl)propanamide |
|---|---|
| PubChem CID | 132663564 |
| Molecular Formula | C19H20F2N2O4S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-(4-prop-2-enoxyphenyl)propanamide |
| SMILES | C=CCOc1ccc(NC(=O)C(C)N(c2ccc(F)c(F)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H20F2N2O4S/c1-4-11-27-16-8-5-14(6-9-16)22-19(24)13(2)23(28(3,25)26)15-7-10-17(20)18(21)12-15/h4-10,12-13H,1,11H2,2-3H3,(H,22,24) |
| InChIKey | HYQIACYYJZCZAC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|