C20H33N3O4S — CID 132663988
2-(4-ethoxy-N-methylsulfonylanilino)-N-[2-(1-methylpiperidin-4-yl)ethyl]propanamide (PubChem CID 132663988) has the molecular formula C20H33N3O4S and a molecular weight of 411.57 g/mol. Its IUPAC name is 2-(4-ethoxy-N-methylsulfonylanilino)-N-[2-(1-methylpiperidin-4-yl)ethyl]propanamide.
| Compound Name | 2-(4-ethoxy-N-methylsulfonylanilino)-N-[2-(1-methylpiperidin-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 132663988 |
| Molecular Formula | C20H33N3O4S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2-(4-ethoxy-N-methylsulfonylanilino)-N-[2-(1-methylpiperidin-4-yl)ethyl]propanamide |
| SMILES | CCOc1ccc(N(C(C)C(=O)NCCC2CCN(C)CC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H33N3O4S/c1-5-27-19-8-6-18(7-9-19)23(28(4,25)26)16(2)20(24)21-13-10-17-11-14-22(3)15-12-17/h6-9,16-17H,5,10-15H2,1-4H3,(H,21,24) |
| InChIKey | XJSSKIJNTWFZBC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |