C23H22ClNO2S — CID 132664011
2-(4-chloro-3-methylphenoxy)-N-[4-(phenylsulfanylmethyl)phenyl]propanamide (PubChem CID 132664011) has the molecular formula C23H22ClNO2S and a molecular weight of 411.95 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[4-(phenylsulfanylmethyl)phenyl]propanamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[4-(phenylsulfanylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 132664011 |
| Molecular Formula | C23H22ClNO2S |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[4-(phenylsulfanylmethyl)phenyl]propanamide |
| SMILES | Cc1cc(OC(C)C(=O)Nc2ccc(CSc3ccccc3)cc2)ccc1Cl |
| InChI | InChI=1S/C23H22ClNO2S/c1-16-14-20(12-13-22(16)24)27-17(2)23(26)25-19-10-8-18(9-11-19)15-28-21-6-4-3-5-7-21/h3-14,17H,15H2,1-2H3,(H,25,26) |
| InChIKey | WWHQIECQQCMGEW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |