C20H25N3O5S — CID 132666078
N-(4-butylphenyl)-2-(N-methylsulfonyl-3-nitroanilino)propanamide (PubChem CID 132666078) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(N-methylsulfonyl-3-nitroanilino)propanamide.
| Compound Name | N-(4-butylphenyl)-2-(N-methylsulfonyl-3-nitroanilino)propanamide |
|---|---|
| PubChem CID | 132666078 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-(4-butylphenyl)-2-(N-methylsulfonyl-3-nitroanilino)propanamide |
| SMILES | CCCCc1ccc(NC(=O)C(C)N(c2cccc([N+](=O)[O-])c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-4-5-7-16-10-12-17(13-11-16)21-20(24)15(2)22(29(3,27)28)18-8-6-9-19(14-18)23(25)26/h6,8-15H,4-5,7H2,1-3H3,(H,21,24) |
| InChIKey | IQVGEYLKZBYLPE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|