C25H27NO3S — CID 132666695
2-benzylsulfanyl-N-[1-(3,4-dimethoxyphenyl)propyl]benzamide (PubChem CID 132666695) has the molecular formula C25H27NO3S and a molecular weight of 421.56 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[1-(3,4-dimethoxyphenyl)propyl]benzamide.
| Compound Name | 2-benzylsulfanyl-N-[1-(3,4-dimethoxyphenyl)propyl]benzamide |
|---|---|
| PubChem CID | 132666695 |
| Molecular Formula | C25H27NO3S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-benzylsulfanyl-N-[1-(3,4-dimethoxyphenyl)propyl]benzamide |
| SMILES | CCC(NC(=O)c1ccccc1SCc1ccccc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H27NO3S/c1-4-21(19-14-15-22(28-2)23(16-19)29-3)26-25(27)20-12-8-9-13-24(20)30-17-18-10-6-5-7-11-18/h5-16,21H,4,17H2,1-3H3,(H,26,27) |
| InChIKey | JFYFCGBEMWDCNT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |