C24H32N2O3S — CID 132668513
N-[1-(2,4-dimethylphenyl)propyl]-3-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 132668513) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)propyl]-3-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[1-(2,4-dimethylphenyl)propyl]-3-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 132668513 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)propyl]-3-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CCC(NC(=O)c1cccc(S(=O)(=O)N2CCC(C)CC2)c1)c1ccc(C)cc1C |
| InChI | InChI=1S/C24H32N2O3S/c1-5-23(22-10-9-18(3)15-19(22)4)25-24(27)20-7-6-8-21(16-20)30(28,29)26-13-11-17(2)12-14-26/h6-10,15-17,23H,5,11-14H2,1-4H3,(H,25,27) |
| InChIKey | CZGSBGOHQAOQFV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |