C22H28N2O5S — CID 132669534
ethyl 2-methyl-3-[2-(3-methyl-N-methylsulfonylanilino)butanoylamino]benzoate (PubChem CID 132669534) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is ethyl 2-methyl-3-[2-(3-methyl-N-methylsulfonylanilino)butanoylamino]benzoate.
| Compound Name | ethyl 2-methyl-3-[2-(3-methyl-N-methylsulfonylanilino)butanoylamino]benzoate |
|---|---|
| PubChem CID | 132669534 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | ethyl 2-methyl-3-[2-(3-methyl-N-methylsulfonylanilino)butanoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)C(CC)N(c2cccc(C)c2)S(C)(=O)=O)c1C |
| InChI | InChI=1S/C22H28N2O5S/c1-6-20(24(30(5,27)28)17-11-8-10-15(3)14-17)21(25)23-19-13-9-12-18(16(19)4)22(26)29-7-2/h8-14,20H,6-7H2,1-5H3,(H,23,25) |
| InChIKey | PCKFNFFEPDWYPF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |