C27H31NO2S — CID 132670053
2-(4-tert-butylphenoxy)-N-[4-(phenylsulfanylmethyl)phenyl]butanamide (PubChem CID 132670053) has the molecular formula C27H31NO2S and a molecular weight of 433.62 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[4-(phenylsulfanylmethyl)phenyl]butanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[4-(phenylsulfanylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 132670053 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[4-(phenylsulfanylmethyl)phenyl]butanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO2S/c1-5-25(30-23-17-13-21(14-18-23)27(2,3)4)26(29)28-22-15-11-20(12-16-22)19-31-24-9-7-6-8-10-24/h6-18,25H,5,19H2,1-4H3,(H,28,29) |
| InChIKey | ONTVAOZQNNWCDL-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |