C21H28N2O6S — CID 132670775
2-(3-methoxy-N-methylsulfonylanilino)-N-[1-(4-methoxyphenoxy)propan-2-yl]propanamide (PubChem CID 132670775) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-(3-methoxy-N-methylsulfonylanilino)-N-[1-(4-methoxyphenoxy)propan-2-yl]propanamide.
| Compound Name | 2-(3-methoxy-N-methylsulfonylanilino)-N-[1-(4-methoxyphenoxy)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 132670775 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-(3-methoxy-N-methylsulfonylanilino)-N-[1-(4-methoxyphenoxy)propan-2-yl]propanamide |
| SMILES | COc1ccc(OCC(C)NC(=O)C(C)N(c2cccc(OC)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H28N2O6S/c1-15(14-29-19-11-9-18(27-3)10-12-19)22-21(24)16(2)23(30(5,25)26)17-7-6-8-20(13-17)28-4/h6-13,15-16H,14H2,1-5H3,(H,22,24) |
| InChIKey | OGJDLWSPCHGKIE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |