C25H28N2O3S — CID 132670888
N-(3-methyl-1-phenylbutyl)-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 132670888) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-(3-methyl-1-phenylbutyl)-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(3-methyl-1-phenylbutyl)-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 132670888 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-(3-methyl-1-phenylbutyl)-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NC(CC(C)C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H28N2O3S/c1-18(2)16-24(20-8-5-4-6-9-20)26-25(28)21-10-7-11-23(17-21)31(29,30)27-22-14-12-19(3)13-15-22/h4-15,17-18,24,27H,16H2,1-3H3,(H,26,28) |
| InChIKey | HOYHMIIUERULAM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |