C7H5F9O — CID 13267236
2-ethoxy-1,1,1,4,4,4-hexafluoro-3-(trifluoromethyl)but-2-ene (PubChem CID 13267236) has the molecular formula C7H5F9O and a molecular weight of 276.10 g/mol. Its IUPAC name is 2-ethoxy-1,1,1,4,4,4-hexafluoro-3-(trifluoromethyl)but-2-ene.
| Compound Name | 2-ethoxy-1,1,1,4,4,4-hexafluoro-3-(trifluoromethyl)but-2-ene |
|---|---|
| PubChem CID | 13267236 |
| Molecular Formula | C7H5F9O |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 2-ethoxy-1,1,1,4,4,4-hexafluoro-3-(trifluoromethyl)but-2-ene |
| SMILES | CCOC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O/c1-2-17-4(7(14,15)16)3(5(8,9)10)6(11,12)13/h2H2,1H3 |
| InChIKey | KZKKVFDPURUAGG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|